C22H28N4O4S — CID 66750764
(2S)-N-[(1S)-2-(4-acetamidophenyl)-1-aminoethyl]-1-(benzenesulfonyl)piperidine-2-carboxamide (PubChem CID 66750764) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is (2S)-N-[(1S)-2-(4-acetamidophenyl)-1-aminoethyl]-1-(benzenesulfonyl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-[(1S)-2-(4-acetamidophenyl)-1-aminoethyl]-1-(benzenesulfonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 66750764 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (2S)-N-[(1S)-2-(4-acetamidophenyl)-1-aminoethyl]-1-(benzenesulfonyl)piperidine-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C[C@@H](N)NC(=O)[C@@H]2CCCCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N4O4S/c1-16(27)24-18-12-10-17(11-13-18)15-21(23)25-22(28)20-9-5-6-14-26(20)31(29,30)19-7-3-2-4-8-19/h2-4,7-8,10-13,20-21H,5-6,9,14-15,23H2,1H3,(H,24,27)(H,25,28)/t20-,21-/m0/s1 |
| InChIKey | OWIHEBCULWXJJT-SFTDATJTSA-N |
| XLogP | 1.83 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|