C22H28N4O5S — CID 66750777
[(2S)-1-(benzenesulfonyl)piperidin-2-yl] N-[(1S)-2-(4-acetamidophenyl)-1-aminoethyl]carbamate (PubChem CID 66750777) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is [(2S)-1-(benzenesulfonyl)piperidin-2-yl] N-[(1S)-2-(4-acetamidophenyl)-1-aminoethyl]carbamate.
| Compound Name | [(2S)-1-(benzenesulfonyl)piperidin-2-yl] N-[(1S)-2-(4-acetamidophenyl)-1-aminoethyl]carbamate |
|---|---|
| PubChem CID | 66750777 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [(2S)-1-(benzenesulfonyl)piperidin-2-yl] N-[(1S)-2-(4-acetamidophenyl)-1-aminoethyl]carbamate |
| SMILES | CC(=O)Nc1ccc(C[C@@H](N)NC(=O)O[C@H]2CCCCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N4O5S/c1-16(27)24-18-12-10-17(11-13-18)15-20(23)25-22(28)31-21-9-5-6-14-26(21)32(29,30)19-7-3-2-4-8-19/h2-4,7-8,10-13,20-21H,5-6,9,14-15,23H2,1H3,(H,24,27)(H,25,28)/t20-,21-/m0/s1 |
| InChIKey | MDMFCWRJLXQRIM-SFTDATJTSA-N |
| XLogP | 2.40 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|