C32H37N3O5S — CID 162123651
2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-[3-(5-iminohexyl)phenyl]phenyl]propanoic acid (PubChem CID 162123651) has the molecular formula C32H37N3O5S and a molecular weight of 575.73 g/mol. Its IUPAC name is 2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-[3-(5-iminohexyl)phenyl]phenyl]propanoic acid.
| Compound Name | 2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-[3-(5-iminohexyl)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 162123651 |
| Molecular Formula | C32H37N3O5S |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 2-[[(2S)-1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-3-[4-[3-(5-iminohexyl)phenyl]phenyl]propanoic acid |
| SMILES | [H]/N=C(\C)CCCCc1cccc(-c2ccc(CC(NC(=O)[C@@H]3CCCN3S(=O)(=O)c3ccccc3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C32H37N3O5S/c1-23(33)9-5-6-10-24-11-7-12-27(21-24)26-18-16-25(17-19-26)22-29(32(37)38)34-31(36)30-15-8-20-35(30)41(39,40)28-13-3-2-4-14-28/h2-4,7,11-14,16-19,21,29-30,33H,5-6,8-10,15,20,22H2,1H3,(H,34,36)(H,37,38)/b33-23+/t29?,30-/m0/s1 |
| InChIKey | FZHSRDDFCRTOMR-SDAWGYODSA-N |
| XLogP | 5.07 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|