C29H34N4O6S2 — CID 157285479
(2S)-2-[[(4R)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carbonyl]amino]-3-[4-(8-cyanoimino-2-oxononyl)phenyl]propanoic acid (PubChem CID 157285479) has the molecular formula C29H34N4O6S2 and a molecular weight of 598.75 g/mol. Its IUPAC name is (2S)-2-[[(4R)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carbonyl]amino]-3-[4-(8-cyanoimino-2-oxononyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(4R)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carbonyl]amino]-3-[4-(8-cyanoimino-2-oxononyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 157285479 |
| Molecular Formula | C29H34N4O6S2 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | (2S)-2-[[(4R)-3-(benzenesulfonyl)-1,3-thiazolidine-4-carbonyl]amino]-3-[4-(8-cyanoimino-2-oxononyl)phenyl]propanoic acid |
| SMILES | C/C(CCCCCC(=O)Cc1ccc(C[C@H](NC(=O)[C@@H]2CSCN2S(=O)(=O)c2ccccc2)C(=O)O)cc1)=N\C#N |
| InChI | InChI=1S/C29H34N4O6S2/c1-21(31-19-30)8-4-2-5-9-24(34)16-22-12-14-23(15-13-22)17-26(29(36)37)32-28(35)27-18-40-20-33(27)41(38,39)25-10-6-3-7-11-25/h3,6-7,10-15,26-27H,2,4-5,8-9,16-18,20H2,1H3,(H,32,35)(H,36,37)/b31-21+/t26-,27-/m0/s1 |
| InChIKey | FKWFATJJPNHQGZ-OJESCIOTSA-N |
| XLogP | 3.57 |
| TPSA | 157.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|