C14H18N2O6S — CID 122105895
5-methyl-1-[(2-nitrophenyl)methylsulfonyl]piperidine-3-carboxylic acid (PubChem CID 122105895) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is 5-methyl-1-[(2-nitrophenyl)methylsulfonyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[(2-nitrophenyl)methylsulfonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122105895 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 5-methyl-1-[(2-nitrophenyl)methylsulfonyl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(S(=O)(=O)Cc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H18N2O6S/c1-10-6-12(14(17)18)8-15(7-10)23(21,22)9-11-4-2-3-5-13(11)16(19)20/h2-5,10,12H,6-9H2,1H3,(H,17,18) |
| InChIKey | SHWVCZXNMIVDPG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|