C8H9ClN2O3 — CID 46907963
8-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (PubChem CID 46907963) has the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. Its IUPAC name is 8-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride.
| Compound Name | 8-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
|---|---|
| PubChem CID | 46907963 |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 8-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccc2c1OCCN2 |
| InChI | InChI=1S/C8H8N2O3.ClH/c11-10(12)7-3-1-2-6-8(7)13-5-4-9-6;/h1-3,9H,4-5H2;1H |
| InChIKey | KQQDXFSKAAPAHF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|