C12H20BrNO — CID 177141875
8-bromo-3,4-dihydro-2H-1,4-benzoxazine;ethane (PubChem CID 177141875) has the molecular formula C12H20BrNO and a molecular weight of 274.20 g/mol. Its IUPAC name is 8-bromo-3,4-dihydro-2H-1,4-benzoxazine;ethane.
| Compound Name | 8-bromo-3,4-dihydro-2H-1,4-benzoxazine;ethane |
|---|---|
| PubChem CID | 177141875 |
| Molecular Formula | C12H20BrNO |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 8-bromo-3,4-dihydro-2H-1,4-benzoxazine;ethane |
| SMILES | Brc1cccc2c1OCCN2.CC.CC |
| InChI | InChI=1S/C8H8BrNO.2C2H6/c9-6-2-1-3-7-8(6)11-5-4-10-7;2*1-2/h1-3,10H,4-5H2;2*1-2H3 |
| InChIKey | GMZAAIGADQQAJO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |