C12H16ClNO — CID 165154481
8-tert-butyl-7-chloro-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 165154481) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 8-tert-butyl-7-chloro-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 8-tert-butyl-7-chloro-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 165154481 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 8-tert-butyl-7-chloro-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC(C)(C)c1c(Cl)ccc2c1OCCN2 |
| InChI | InChI=1S/C12H16ClNO/c1-12(2,3)10-8(13)4-5-9-11(10)15-7-6-14-9/h4-5,14H,6-7H2,1-3H3 |
| InChIKey | LEVDTQOBWKHOJH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |