C13H13N3O4 — CID 174444748
azane;bicyclo[2.2.1]hepta-1,3,5-triene;1,2-dinitrobenzene (PubChem CID 174444748) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is azane;bicyclo[2.2.1]hepta-1,3,5-triene;1,2-dinitrobenzene.
| Compound Name | azane;bicyclo[2.2.1]hepta-1,3,5-triene;1,2-dinitrobenzene |
|---|---|
| PubChem CID | 174444748 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | azane;bicyclo[2.2.1]hepta-1,3,5-triene;1,2-dinitrobenzene |
| SMILES | C1=CC2=CC=C1C2.N.O=[N+]([O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6.C6H4N2O4.H3N/c1-2-7-4-3-6(1)5-7;9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,5H2;1-4H;1H3 |
| InChIKey | GHGLFCKBMXTBOV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|