About 1-nitro-2-(selanylidene-λ4-selanyl)benzene
1-nitro-2-(selanylidene-λ4-selanyl)benzene (PubChem CID 150274158) has the molecular formula C6H5NO2Se2
and a molecular weight of 281.03 g/mol. Its IUPAC name is 1-nitro-2-(selanylidene-λ4-selanyl)benzene.
Molecular Properties
| Compound Name | 1-nitro-2-(selanylidene-λ4-selanyl)benzene |
| PubChem CID | 150274158 |
| Molecular Formula | C6H5NO2Se2 |
| Molecular Weight | 281.03 g/mol |
| Exact Mass | 282.87 |
| IUPAC Name | 1-nitro-2-(selanylidene-λ4-selanyl)benzene |
| SMILES | O=[N+]([O-])c1ccccc1[SeH]=[Se] |
| InChI | InChI=1S/C6H5NO2Se2/c8-7(9)5-3-1-2-4-6(5)11-10/h1-4,11H |
| InChIKey | GEESNIAVJDJHJC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.03 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-2-(selanylidene-λ4-selanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-2-(selanylidene-λ4-selanyl)benzene?
The IUPAC name of 1-nitro-2-(selanylidene-λ4-selanyl)benzene (CID 150274158) is 1-nitro-2-(selanylidene-λ4-selanyl)benzene.
What is the SMILES notation for 1-nitro-2-(selanylidene-λ4-selanyl)benzene?
The canonical SMILES for 1-nitro-2-(selanylidene-λ4-selanyl)benzene is O=[N+]([O-])c1ccccc1[SeH]=[Se].
What is the InChIKey of 1-nitro-2-(selanylidene-λ4-selanyl)benzene?
The InChIKey is GEESNIAVJDJHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2Se2/c8-7(9)5-3-1-2-4-6(5)11-10/h1-4,11H.
What are the key properties of 1-nitro-2-(selanylidene-λ4-selanyl)benzene?
1-nitro-2-(selanylidene-λ4-selanyl)benzene has a molecular weight of 281.03 g/mol, XLogP of -0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-2-(selanylidene-λ4-selanyl)benzene is sourced from PubChem (CID 150274158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).