About aziridin-1-ium;2-nitrophenolate
aziridin-1-ium;2-nitrophenolate (PubChem CID 159334140) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is aziridin-1-ium;2-nitrophenolate.
Molecular Properties
| Compound Name | aziridin-1-ium;2-nitrophenolate |
| PubChem CID | 159334140 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | aziridin-1-ium;2-nitrophenolate |
| SMILES | C1C[NH2+]1.O=[N+]([O-])c1ccccc1[O-] |
| InChI | InChI=1S/C6H5NO3.C2H5N/c8-6-4-2-1-3-5(6)7(9)10;1-2-3-1/h1-4,8H;3H,1-2H2 |
| InChIKey | LFHUXOIUOYYQHK-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridin-1-ium;2-nitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridin-1-ium;2-nitrophenolate?
The IUPAC name of aziridin-1-ium;2-nitrophenolate (CID 159334140) is aziridin-1-ium;2-nitrophenolate.
What is the SMILES notation for aziridin-1-ium;2-nitrophenolate?
The canonical SMILES for aziridin-1-ium;2-nitrophenolate is C1C[NH2+]1.O=[N+]([O-])c1ccccc1[O-].
What is the InChIKey of aziridin-1-ium;2-nitrophenolate?
The InChIKey is LFHUXOIUOYYQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3.C2H5N/c8-6-4-2-1-3-5(6)7(9)10;1-2-3-1/h1-4,8H;3H,1-2H2.
What are the key properties of aziridin-1-ium;2-nitrophenolate?
aziridin-1-ium;2-nitrophenolate has a molecular weight of 182.18 g/mol, XLogP of -0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aziridin-1-ium;2-nitrophenolate is sourced from PubChem (CID 159334140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).