About 6-methylpyridin-1-ium-2-amine;2-nitrophenolate
6-methylpyridin-1-ium-2-amine;2-nitrophenolate (PubChem CID 134163486) has the molecular formula C12H13N3O3
and a molecular weight of 247.25 g/mol. Its IUPAC name is 6-methylpyridin-1-ium-2-amine;2-nitrophenolate.
Molecular Properties
| Compound Name | 6-methylpyridin-1-ium-2-amine;2-nitrophenolate |
| PubChem CID | 134163486 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 6-methylpyridin-1-ium-2-amine;2-nitrophenolate |
| SMILES | Cc1cccc(N)[nH+]1.O=[N+]([O-])c1ccccc1[O-] |
| InChI | InChI=1S/C6H8N2.C6H5NO3/c1-5-3-2-4-6(7)8-5;8-6-4-2-1-3-5(6)7(9)10/h2-4H,1H3,(H2,7,8);1-4,8H |
| InChIKey | FRWKVYFURYANFE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methylpyridin-1-ium-2-amine;2-nitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyridin-1-ium-2-amine;2-nitrophenolate?
The IUPAC name of 6-methylpyridin-1-ium-2-amine;2-nitrophenolate (CID 134163486) is 6-methylpyridin-1-ium-2-amine;2-nitrophenolate.
What is the SMILES notation for 6-methylpyridin-1-ium-2-amine;2-nitrophenolate?
The canonical SMILES for 6-methylpyridin-1-ium-2-amine;2-nitrophenolate is Cc1cccc(N)[nH+]1.O=[N+]([O-])c1ccccc1[O-].
What is the InChIKey of 6-methylpyridin-1-ium-2-amine;2-nitrophenolate?
The InChIKey is FRWKVYFURYANFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C6H5NO3/c1-5-3-2-4-6(7)8-5;8-6-4-2-1-3-5(6)7(9)10/h2-4H,1H3,(H2,7,8);1-4,8H.
What are the key properties of 6-methylpyridin-1-ium-2-amine;2-nitrophenolate?
6-methylpyridin-1-ium-2-amine;2-nitrophenolate has a molecular weight of 247.25 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyridin-1-ium-2-amine;2-nitrophenolate is sourced from PubChem (CID 134163486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).