C18H14N4O7 — CID 11058408
1-(2,4-dinitrophenyl)-4-methylpyridin-1-ium;2-nitrophenolate (PubChem CID 11058408) has the molecular formula C18H14N4O7 and a molecular weight of 398.33 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-4-methylpyridin-1-ium;2-nitrophenolate.
| Compound Name | 1-(2,4-dinitrophenyl)-4-methylpyridin-1-ium;2-nitrophenolate |
|---|---|
| PubChem CID | 11058408 |
| Molecular Formula | C18H14N4O7 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-4-methylpyridin-1-ium;2-nitrophenolate |
| SMILES | Cc1cc[n+](-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1.O=[N+]([O-])c1ccccc1[O-] |
| InChI | InChI=1S/C12H10N3O4.C6H5NO3/c1-9-4-6-13(7-5-9)11-3-2-10(14(16)17)8-12(11)15(18)19;8-6-4-2-1-3-5(6)7(9)10/h2-8H,1H3;1-4,8H/q+1;/p-1 |
| InChIKey | OBUQBJZJEVWKQJ-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 156.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|