C12H10ClN4O5+ — CID 86761100
1-(2,4-dinitrophenyl)pyridin-1-ium-4-carboxamide;hydrochloride (PubChem CID 86761100) has the molecular formula C12H10ClN4O5+ and a molecular weight of 325.69 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)pyridin-1-ium-4-carboxamide;hydrochloride.
| Compound Name | 1-(2,4-dinitrophenyl)pyridin-1-ium-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 86761100 |
| Molecular Formula | C12H10ClN4O5+ |
| Molecular Weight | 325.69 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 1-(2,4-dinitrophenyl)pyridin-1-ium-4-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cc[n+](-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H8N4O5.ClH/c13-12(17)8-3-5-14(6-4-8)10-2-1-9(15(18)19)7-11(10)16(20)21;/h1-7H,(H-,13,17);1H/p+1 |
| InChIKey | HIOBFQOMFBWKAT-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.69 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|