C22H16N6O8+2 — CID 101412719
(3E,5Z,9Z,11E)-1,7-bis(2,4-dinitrophenyl)-1,7-diazoniacyclododeca-1,3,5,7,9,11-hexaene (PubChem CID 101412719) has the molecular formula C22H16N6O8+2 and a molecular weight of 492.40 g/mol. Its IUPAC name is (3E,5Z,9Z,11E)-1,7-bis(2,4-dinitrophenyl)-1,7-diazoniacyclododeca-1,3,5,7,9,11-hexaene.
| Compound Name | (3E,5Z,9Z,11E)-1,7-bis(2,4-dinitrophenyl)-1,7-diazoniacyclododeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 101412719 |
| Molecular Formula | C22H16N6O8+2 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (3E,5Z,9Z,11E)-1,7-bis(2,4-dinitrophenyl)-1,7-diazoniacyclododeca-1,3,5,7,9,11-hexaene |
| SMILES | O=[N+]([O-])c1ccc([N+]2=C\C=C/C=C/[N+](c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])=C\C=C\C=C\2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16N6O8/c29-25(30)17-7-9-19(21(15-17)27(33)34)23-11-3-1-4-12-24(14-6-2-5-13-23)20-10-8-18(26(31)32)16-22(20)28(35)36/h1-16H/q+2/b3-1-,4-1-,5-2+,6-2+,11-3+,12-4+,13-5-,14-6-,23-11-,23-13+,24-12-,24-14+ |
| InChIKey | LODXJUISGPCOIY-SISGZBFXSA-N |
| XLogP | 4.60 |
| TPSA | 178.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|