C42H32N6O14S2 — CID 140885425
1-(2,4-dinitrophenyl)-4-[4-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]phenyl]pyridin-1-ium;bis(4-methylbenzenesulfonate) (PubChem CID 140885425) has the molecular formula C42H32N6O14S2 and a molecular weight of 908.88 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-4-[4-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]phenyl]pyridin-1-ium;bis(4-methylbenzenesulfonate).
| Compound Name | 1-(2,4-dinitrophenyl)-4-[4-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]phenyl]pyridin-1-ium;bis(4-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 140885425 |
| Molecular Formula | C42H32N6O14S2 |
| Molecular Weight | 908.88 g/mol |
| Exact Mass | 908.14 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-4-[4-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]phenyl]pyridin-1-ium;bis(4-methylbenzenesulfonate) |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1.O=[N+]([O-])c1ccc(-[n+]2ccc(-c3ccc(-c4cc[n+](-c5ccc([N+](=O)[O-])cc5[N+](=O)[O-])cc4)cc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H18N6O8.2C7H8O3S/c35-31(36)23-5-7-25(27(17-23)33(39)40)29-13-9-21(10-14-29)19-1-2-20(4-3-19)22-11-15-30(16-12-22)26-8-6-24(32(37)38)18-28(26)34(41)42;2*1-6-2-4-7(5-3-6)11(8,9)10/h1-18H;2*2-5H,1H3,(H,8,9,10)/q+2;;/p-2 |
| InChIKey | YZOSHLMKWYINQZ-UHFFFAOYSA-L |
| XLogP | 7.01 |
| TPSA | 294.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.88 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|