C12H11N4O7S+ — CID 139216729
1-(2,4-dinitrophenyl)-4-methoxypyridin-1-ium-3-sulfonamide (PubChem CID 139216729) has the molecular formula C12H11N4O7S+ and a molecular weight of 355.31 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-4-methoxypyridin-1-ium-3-sulfonamide.
| Compound Name | 1-(2,4-dinitrophenyl)-4-methoxypyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 139216729 |
| Molecular Formula | C12H11N4O7S+ |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-4-methoxypyridin-1-ium-3-sulfonamide |
| SMILES | COc1cc[n+](-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H11N4O7S/c1-23-11-4-5-14(7-12(11)24(13,21)22)9-3-2-8(15(17)18)6-10(9)16(19)20/h2-7H,1H3,(H2,13,21,22)/q+1 |
| InChIKey | DKYPJCQIICXDBU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 159.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|