C22H18N6O4+2 — CID 144970218
4-[4-[1-(2-amino-4-nitrophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-3-nitroaniline (PubChem CID 144970218) has the molecular formula C22H18N6O4+2 and a molecular weight of 430.42 g/mol. Its IUPAC name is 4-[4-[1-(2-amino-4-nitrophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-3-nitroaniline.
| Compound Name | 4-[4-[1-(2-amino-4-nitrophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-3-nitroaniline |
|---|---|
| PubChem CID | 144970218 |
| Molecular Formula | C22H18N6O4+2 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-[4-[1-(2-amino-4-nitrophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]-3-nitroaniline |
| SMILES | Nc1ccc(-[n+]2ccc(-c3cc[n+](-c4ccc([N+](=O)[O-])cc4N)cc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H17N6O4/c23-17-1-3-21(22(13-17)28(31)32)26-11-7-16(8-12-26)15-5-9-25(10-6-15)20-4-2-18(27(29)30)14-19(20)24/h1-14,24H,23H2/q+1/p+1 |
| InChIKey | OXZQZISQKVLUTH-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 146.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|