C23H19N4O7P — CID 172749236
[1-[[4-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]cyclohexa-2,4-dien-1-yl]-dioxido-oxo-λ5-phosphane (PubChem CID 172749236) has the molecular formula C23H19N4O7P and a molecular weight of 494.40 g/mol. Its IUPAC name is [1-[[4-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]cyclohexa-2,4-dien-1-yl]-dioxido-oxo-λ5-phosphane.
| Compound Name | [1-[[4-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]cyclohexa-2,4-dien-1-yl]-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 172749236 |
| Molecular Formula | C23H19N4O7P |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | [1-[[4-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]cyclohexa-2,4-dien-1-yl]-dioxido-oxo-λ5-phosphane |
| SMILES | O=[N+]([O-])c1ccc(-[n+]2ccc(-c3cc[n+](CC4(P(=O)([O-])[O-])C=CC=CC4)cc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H19N4O7P/c28-26(29)20-4-5-21(22(16-20)27(30)31)25-14-8-19(9-15-25)18-6-12-24(13-7-18)17-23(35(32,33)34)10-2-1-3-11-23/h1-10,12-16H,11,17H2 |
| InChIKey | KDLXZUFKGXFYQH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 157.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|