C16H15N4O4+ — CID 144980113
N-[(Z)-3-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]prop-1-enyl]ethanimine (PubChem CID 144980113) has the molecular formula C16H15N4O4+ and a molecular weight of 327.32 g/mol. Its IUPAC name is N-[(Z)-3-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]prop-1-enyl]ethanimine.
| Compound Name | N-[(Z)-3-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]prop-1-enyl]ethanimine |
|---|---|
| PubChem CID | 144980113 |
| Molecular Formula | C16H15N4O4+ |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[(Z)-3-[1-(2,4-dinitrophenyl)pyridin-1-ium-4-yl]prop-1-enyl]ethanimine |
| SMILES | C/C=N/C=C\Cc1cc[n+](-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15N4O4/c1-2-17-9-3-4-13-7-10-18(11-8-13)15-6-5-14(19(21)22)12-16(15)20(23)24/h2-3,5-12H,4H2,1H3/q+1/b9-3-,17-2+ |
| InChIKey | BNISJEOAIIXIHW-DMLMQXNBSA-N |
| XLogP | 2.93 |
| TPSA | 102.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|