C16H13N4O4+ — CID 102578253
1-(2,4-dinitrophenyl)-3-(4-methylphenyl)imidazol-1-ium (PubChem CID 102578253) has the molecular formula C16H13N4O4+ and a molecular weight of 325.30 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-3-(4-methylphenyl)imidazol-1-ium.
| Compound Name | 1-(2,4-dinitrophenyl)-3-(4-methylphenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 102578253 |
| Molecular Formula | C16H13N4O4+ |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-3-(4-methylphenyl)imidazol-1-ium |
| SMILES | Cc1ccc(-n2cc[n+](-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H13N4O4/c1-12-2-4-13(5-3-12)17-8-9-18(11-17)15-7-6-14(19(21)22)10-16(15)20(23)24/h2-11H,1H3/q+1 |
| InChIKey | TWRNFNMWKAOTSY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|