C15H13N4O4+ — CID 54453884
3-[1-(4-methyl-2-nitrophenyl)pyridin-1-ium-4-yl]imidazolidine-2,4-dione (PubChem CID 54453884) has the molecular formula C15H13N4O4+ and a molecular weight of 313.29 g/mol. Its IUPAC name is 3-[1-(4-methyl-2-nitrophenyl)pyridin-1-ium-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(4-methyl-2-nitrophenyl)pyridin-1-ium-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 54453884 |
| Molecular Formula | C15H13N4O4+ |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-[1-(4-methyl-2-nitrophenyl)pyridin-1-ium-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(-[n+]2ccc(N3C(=O)CNC3=O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12N4O4/c1-10-2-3-12(13(8-10)19(22)23)17-6-4-11(5-7-17)18-14(20)9-16-15(18)21/h2-8H,9H2,1H3/p+1 |
| InChIKey | HLLRENJDUTVRIE-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|