C11H14ClN3O5S — CID 68802288
1-(4-methyl-2-nitrophenyl)sulfonylpiperazin-2-one;hydrochloride (PubChem CID 68802288) has the molecular formula C11H14ClN3O5S and a molecular weight of 335.77 g/mol. Its IUPAC name is 1-(4-methyl-2-nitrophenyl)sulfonylpiperazin-2-one;hydrochloride.
| Compound Name | 1-(4-methyl-2-nitrophenyl)sulfonylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 68802288 |
| Molecular Formula | C11H14ClN3O5S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 1-(4-methyl-2-nitrophenyl)sulfonylpiperazin-2-one;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNCC2=O)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C11H13N3O5S.ClH/c1-8-2-3-10(9(6-8)14(16)17)20(18,19)13-5-4-12-7-11(13)15;/h2-3,6,12H,4-5,7H2,1H3;1H |
| InChIKey | ZHHVUDUONFZSMK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|