C11H11ClF3N3O5S — CID 68798537
1-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpiperazin-2-one;hydrochloride (PubChem CID 68798537) has the molecular formula C11H11ClF3N3O5S and a molecular weight of 389.74 g/mol. Its IUPAC name is 1-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpiperazin-2-one;hydrochloride.
| Compound Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 68798537 |
| Molecular Formula | C11H11ClF3N3O5S |
| Molecular Weight | 389.74 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpiperazin-2-one;hydrochloride |
| SMILES | Cl.O=C1CNCCN1S(=O)(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10F3N3O5S.ClH/c12-11(13,14)7-1-2-9(8(5-7)17(19)20)23(21,22)16-4-3-15-6-10(16)18;/h1-2,5,15H,3-4,6H2;1H |
| InChIKey | LJVWYSPFSVRRFH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.74 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|