C21H19N3O5S — CID 163333070
4-methylbenzenesulfonate;1-methyl-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-4-ium (PubChem CID 163333070) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;1-methyl-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-4-ium.
| Compound Name | 4-methylbenzenesulfonate;1-methyl-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 163333070 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 4-methylbenzenesulfonate;1-methyl-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-4-ium |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Cn1c(-c2ccc([N+](=O)[O-])cc2)c[n+]2ccccc12 |
| InChI | InChI=1S/C14H12N3O2.C7H8O3S/c1-15-13(10-16-9-3-2-4-14(15)16)11-5-7-12(8-6-11)17(18)19;1-6-2-4-7(5-3-6)11(8,9)10/h2-10H,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | KMAITRBCPBOGRV-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|