C27H25N3O4S — CID 146109805
4-methylbenzenesulfonate;N-[4-(3-methylimidazo[1,2-a]quinolin-10-ium-2-yl)phenyl]acetamide (PubChem CID 146109805) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;N-[4-(3-methylimidazo[1,2-a]quinolin-10-ium-2-yl)phenyl]acetamide.
| Compound Name | 4-methylbenzenesulfonate;N-[4-(3-methylimidazo[1,2-a]quinolin-10-ium-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 146109805 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 4-methylbenzenesulfonate;N-[4-(3-methylimidazo[1,2-a]quinolin-10-ium-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2c[n+]3c4ccccc4ccc3n2C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C20H17N3O.C7H8O3S/c1-14(24)21-17-10-7-16(8-11-17)19-13-23-18-6-4-3-5-15(18)9-12-20(23)22(19)2;1-6-2-4-7(5-3-6)11(8,9)10/h3-13H,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | WFYNYSUUWGUMJN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|