C44H40N5O6S+ — CID 54604189
4-N-(1-ethylquinolin-1-ium-6-yl)-1-N-[4-[(1-ethylquinolin-1-ium-6-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide;4-methylbenzenesulfonate (PubChem CID 54604189) has the molecular formula C44H40N5O6S+ and a molecular weight of 766.90 g/mol. Its IUPAC name is 4-N-(1-ethylquinolin-1-ium-6-yl)-1-N-[4-[(1-ethylquinolin-1-ium-6-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide;4-methylbenzenesulfonate.
| Compound Name | 4-N-(1-ethylquinolin-1-ium-6-yl)-1-N-[4-[(1-ethylquinolin-1-ium-6-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54604189 |
| Molecular Formula | C44H40N5O6S+ |
| Molecular Weight | 766.90 g/mol |
| Exact Mass | 766.27 |
| IUPAC Name | 4-N-(1-ethylquinolin-1-ium-6-yl)-1-N-[4-[(1-ethylquinolin-1-ium-6-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide;4-methylbenzenesulfonate |
| SMILES | CC[n+]1cccc2cc(NC(=O)c3ccc(NC(=O)c4ccc(C(=O)Nc5ccc6c(ccc[n+]6CC)c5)cc4)cc3)ccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C37H31N5O3.C7H8O3S/c1-3-41-21-5-7-28-23-31(17-19-33(28)41)39-36(44)26-11-9-25(10-12-26)35(43)38-30-15-13-27(14-16-30)37(45)40-32-18-20-34-29(24-32)8-6-22-42(34)4-2;1-6-2-4-7(5-3-6)11(8,9)10/h5-24H,3-4H2,1-2H3,(H-2,38,39,40,43,44,45);2-5H,1H3,(H,8,9,10)/p+1 |
| InChIKey | BMJRGIQTVBIOLZ-UHFFFAOYSA-O |
| XLogP | 7.26 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.90 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|