C34H34N6O2+2 — CID 21128058
1-N,4-N-bis[4-[(1-ethylpyridin-1-ium-2-yl)amino]phenyl]benzene-1,4-dicarboxamide (PubChem CID 21128058) has the molecular formula C34H34N6O2+2 and a molecular weight of 558.69 g/mol. Its IUPAC name is 1-N,4-N-bis[4-[(1-ethylpyridin-1-ium-2-yl)amino]phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-[(1-ethylpyridin-1-ium-2-yl)amino]phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 21128058 |
| Molecular Formula | C34H34N6O2+2 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 1-N,4-N-bis[4-[(1-ethylpyridin-1-ium-2-yl)amino]phenyl]benzene-1,4-dicarboxamide |
| SMILES | CC[n+]1ccccc1Nc1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(Nc4cccc[n+]4CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H32N6O2/c1-3-39-23-7-5-9-31(39)35-27-15-19-29(20-16-27)37-33(41)25-11-13-26(14-12-25)34(42)38-30-21-17-28(18-22-30)36-32-10-6-8-24-40(32)4-2/h5-24H,3-4H2,1-2H3,(H2,37,38,41,42)/p+2 |
| InChIKey | MLEVKZSIFCUDJY-UHFFFAOYSA-P |
| XLogP | 6.29 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|