C50H48N6O10S2 — CID 21127593
1-N,4-N-bis[4-[(1-ethylpyridin-1-ium-2-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) (PubChem CID 21127593) has the molecular formula C50H48N6O10S2 and a molecular weight of 957.10 g/mol. Its IUPAC name is 1-N,4-N-bis[4-[(1-ethylpyridin-1-ium-2-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate).
| Compound Name | 1-N,4-N-bis[4-[(1-ethylpyridin-1-ium-2-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 21127593 |
| Molecular Formula | C50H48N6O10S2 |
| Molecular Weight | 957.10 g/mol |
| Exact Mass | 956.29 |
| IUPAC Name | 1-N,4-N-bis[4-[(1-ethylpyridin-1-ium-2-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) |
| SMILES | CC[n+]1ccccc1NC(=O)c1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(C(=O)Nc4cccc[n+]4CC)cc3)cc2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C36H32N6O4.2C7H8O3S/c1-3-41-23-7-5-9-31(41)39-35(45)27-15-19-29(20-16-27)37-33(43)25-11-13-26(14-12-25)34(44)38-30-21-17-28(18-22-30)36(46)40-32-10-6-8-24-42(32)4-2;2*1-6-2-4-7(5-3-6)11(8,9)10/h5-24H,3-4H2,1-2H3,(H2,37,38,43,44,45,46);2*2-5H,1H3,(H,8,9,10) |
| InChIKey | RRWAYUDZOYCAAR-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 238.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.10 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|