C20H17N2+ — CID 3293402
1-(4-methylphenyl)-2-phenylimidazo[1,2-a]pyridin-4-ium (PubChem CID 3293402) has the molecular formula C20H17N2+ and a molecular weight of 285.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-phenylimidazo[1,2-a]pyridin-4-ium.
| Compound Name | 1-(4-methylphenyl)-2-phenylimidazo[1,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 3293402 |
| Molecular Formula | C20H17N2+ |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-(4-methylphenyl)-2-phenylimidazo[1,2-a]pyridin-4-ium |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)c[n+]3ccccc23)cc1 |
| InChI | InChI=1S/C20H17N2/c1-16-10-12-18(13-11-16)22-19(17-7-3-2-4-8-17)15-21-14-6-5-9-20(21)22/h2-15H,1H3/q+1 |
| InChIKey | BRSDHZQIWXRHQP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|