C21H19BrN2O — CID 21178993
2-(4-methoxyphenyl)-1-(4-methylphenyl)imidazo[1,2-a]pyridin-4-ium bromide (PubChem CID 21178993) has the molecular formula C21H19BrN2O and a molecular weight of 395.30 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-(4-methylphenyl)imidazo[1,2-a]pyridin-4-ium bromide.
| Compound Name | 2-(4-methoxyphenyl)-1-(4-methylphenyl)imidazo[1,2-a]pyridin-4-ium bromide |
|---|---|
| PubChem CID | 21178993 |
| Molecular Formula | C21H19BrN2O |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-(4-methylphenyl)imidazo[1,2-a]pyridin-4-ium bromide |
| SMILES | COc1ccc(-c2c[n+]3ccccc3n2-c2ccc(C)cc2)cc1.[Br-] |
| InChI | InChI=1S/C21H19N2O.BrH/c1-16-6-10-18(11-7-16)23-20(15-22-14-4-3-5-21(22)23)17-8-12-19(24-2)13-9-17;/h3-15H,1-2H3;1H/q+1;/p-1 |
| InChIKey | CGXSYVKQWPODHW-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 18.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|