C19H20BrN2+ — CID 126956899
2-(4-methylphenyl)-1-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium;hydrobromide (PubChem CID 126956899) has the molecular formula C19H20BrN2+ and a molecular weight of 356.29 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium;hydrobromide.
| Compound Name | 2-(4-methylphenyl)-1-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium;hydrobromide |
|---|---|
| PubChem CID | 126956899 |
| Molecular Formula | C19H20BrN2+ |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-(4-methylphenyl)-1-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium;hydrobromide |
| SMILES | Br.Cc1ccc(-c2c[n+]3c(n2-c2ccccc2)CCC3)cc1 |
| InChI | InChI=1S/C19H19N2.BrH/c1-15-9-11-16(12-10-15)18-14-20-13-5-8-19(20)21(18)17-6-3-2-4-7-17;/h2-4,6-7,9-12,14H,5,8,13H2,1H3;1H/q+1; |
| InChIKey | GBKZHCQJQILQRT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|