C21H21F2N2O+ — CID 4087499
1-[4-(difluoromethoxy)phenyl]-2-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium (PubChem CID 4087499) has the molecular formula C21H21F2N2O+ and a molecular weight of 355.41 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium |
|---|---|
| PubChem CID | 4087499 |
| Molecular Formula | C21H21F2N2O+ |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium |
| SMILES | FC(F)Oc1ccc(-n2c(-c3ccccc3)c[n+]3c2CCCCC3)cc1 |
| InChI | InChI=1S/C21H21F2N2O/c22-21(23)26-18-12-10-17(11-13-18)25-19(16-7-3-1-4-8-16)15-24-14-6-2-5-9-20(24)25/h1,3-4,7-8,10-13,15,21H,2,5-6,9,14H2/q+1 |
| InChIKey | AZSMSXAKQMXWCL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|