About difluoromethoxybenzene;ethane
difluoromethoxybenzene;ethane (PubChem CID 142246454) has the molecular formula C9H12F2O
and a molecular weight of 174.19 g/mol. Its IUPAC name is difluoromethoxybenzene;ethane.
Molecular Properties
| Compound Name | difluoromethoxybenzene;ethane |
| PubChem CID | 142246454 |
| Molecular Formula | C9H12F2O |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | difluoromethoxybenzene;ethane |
| SMILES | CC.FC(F)Oc1ccccc1 |
| InChI | InChI=1S/C7H6F2O.C2H6/c8-7(9)10-6-4-2-1-3-5-6;1-2/h1-5,7H;1-2H3 |
| InChIKey | WJPKQEKNXJFYRK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze difluoromethoxybenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethoxybenzene;ethane?
The IUPAC name of difluoromethoxybenzene;ethane (CID 142246454) is difluoromethoxybenzene;ethane.
What is the SMILES notation for difluoromethoxybenzene;ethane?
The canonical SMILES for difluoromethoxybenzene;ethane is CC.FC(F)Oc1ccccc1.
What is the InChIKey of difluoromethoxybenzene;ethane?
The InChIKey is WJPKQEKNXJFYRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2O.C2H6/c8-7(9)10-6-4-2-1-3-5-6;1-2/h1-5,7H;1-2H3.
What are the key properties of difluoromethoxybenzene;ethane?
difluoromethoxybenzene;ethane has a molecular weight of 174.19 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethoxybenzene;ethane is sourced from PubChem (CID 142246454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).