C22H23F4N2O3+ — CID 45135304
1,3-bis[4-(difluoromethoxy)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol (PubChem CID 45135304) has the molecular formula C22H23F4N2O3+ and a molecular weight of 439.43 g/mol. Its IUPAC name is 1,3-bis[4-(difluoromethoxy)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol.
| Compound Name | 1,3-bis[4-(difluoromethoxy)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
|---|---|
| PubChem CID | 45135304 |
| Molecular Formula | C22H23F4N2O3+ |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1,3-bis[4-(difluoromethoxy)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
| SMILES | OC1(c2ccc(OC(F)F)cc2)CN(c2ccc(OC(F)F)cc2)C2=[N+]1CCCCC2 |
| InChI | InChI=1S/C22H23F4N2O3/c23-20(24)30-17-9-5-15(6-10-17)22(29)14-27(19-4-2-1-3-13-28(19)22)16-7-11-18(12-8-16)31-21(25)26/h5-12,20-21,29H,1-4,13-14H2/q+1 |
| InChIKey | ZHCBDQRFHCRSDK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|