C21H23F2N2O2+ — CID 7031182
(3S)-3-[4-(difluoromethoxy)phenyl]-1-(2-methylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol (PubChem CID 7031182) has the molecular formula C21H23F2N2O2+ and a molecular weight of 373.42 g/mol. Its IUPAC name is (3S)-3-[4-(difluoromethoxy)phenyl]-1-(2-methylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol.
| Compound Name | (3S)-3-[4-(difluoromethoxy)phenyl]-1-(2-methylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
|---|---|
| PubChem CID | 7031182 |
| Molecular Formula | C21H23F2N2O2+ |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (3S)-3-[4-(difluoromethoxy)phenyl]-1-(2-methylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
| SMILES | Cc1ccccc1N1C[C@@](O)(c2ccc(OC(F)F)cc2)[N+]2=C1CCCC2 |
| InChI | InChI=1S/C21H23F2N2O2/c1-15-6-2-3-7-18(15)24-14-21(26,25-13-5-4-8-19(24)25)16-9-11-17(12-10-16)27-20(22)23/h2-3,6-7,9-12,20,26H,4-5,8,13-14H2,1H3/q+1/t21-/m1/s1 |
| InChIKey | SXGYKXDQEKSMKL-OAQYLSRUSA-N |
| XLogP | 3.86 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|