C21H22BrClF2N2O2 — CID 45132242
3-(4-chlorophenyl)-1-[4-(difluoromethoxy)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide (PubChem CID 45132242) has the molecular formula C21H22BrClF2N2O2 and a molecular weight of 487.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[4-(difluoromethoxy)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide.
| Compound Name | 3-(4-chlorophenyl)-1-[4-(difluoromethoxy)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
|---|---|
| PubChem CID | 45132242 |
| Molecular Formula | C21H22BrClF2N2O2 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[4-(difluoromethoxy)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
| SMILES | OC1(c2ccc(Cl)cc2)CN(c2ccc(OC(F)F)cc2)C2=[N+]1CCCCC2.[Br-] |
| InChI | InChI=1S/C21H22ClF2N2O2.BrH/c22-16-7-5-15(6-8-16)21(27)14-25(19-4-2-1-3-13-26(19)21)17-9-11-18(12-10-17)28-20(23)24;/h5-12,20,27H,1-4,13-14H2;1H/q+1;/p-1 |
| InChIKey | NGQFECIOKWXFNN-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|