C22H25F2N2O3+ — CID 1237072
(3S)-1-[4-(difluoromethoxy)phenyl]-3-(4-methoxyphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol (PubChem CID 1237072) has the molecular formula C22H25F2N2O3+ and a molecular weight of 403.45 g/mol. Its IUPAC name is (3S)-1-[4-(difluoromethoxy)phenyl]-3-(4-methoxyphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol.
| Compound Name | (3S)-1-[4-(difluoromethoxy)phenyl]-3-(4-methoxyphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
|---|---|
| PubChem CID | 1237072 |
| Molecular Formula | C22H25F2N2O3+ |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (3S)-1-[4-(difluoromethoxy)phenyl]-3-(4-methoxyphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
| SMILES | COc1ccc([C@]2(O)CN(c3ccc(OC(F)F)cc3)C3=[N+]2CCCCC3)cc1 |
| InChI | InChI=1S/C22H25F2N2O3/c1-28-18-10-6-16(7-11-18)22(27)15-25(20-5-3-2-4-14-26(20)22)17-8-12-19(13-9-17)29-21(23)24/h6-13,21,27H,2-5,14-15H2,1H3/q+1/t22-/m1/s1 |
| InChIKey | MTUSOZWNIFXTBY-JOCHJYFZSA-N |
| XLogP | 3.95 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|