C20H22BrN2O2+ — CID 7031129
(3R)-3-(4-bromophenyl)-1-(4-methoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol (PubChem CID 7031129) has the molecular formula C20H22BrN2O2+ and a molecular weight of 402.31 g/mol. Its IUPAC name is (3R)-3-(4-bromophenyl)-1-(4-methoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol.
| Compound Name | (3R)-3-(4-bromophenyl)-1-(4-methoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
|---|---|
| PubChem CID | 7031129 |
| Molecular Formula | C20H22BrN2O2+ |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (3R)-3-(4-bromophenyl)-1-(4-methoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
| SMILES | COc1ccc(N2C[C@](O)(c3ccc(Br)cc3)[N+]3=C2CCCC3)cc1 |
| InChI | InChI=1S/C20H22BrN2O2/c1-25-18-11-9-17(10-12-18)22-14-20(24,15-5-7-16(21)8-6-15)23-13-3-2-4-19(22)23/h5-12,24H,2-4,13-14H2,1H3/q+1/t20-/m0/s1 |
| InChIKey | IQAJXBOMJNIWSQ-FQEVSTJZSA-N |
| XLogP | 3.72 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|