C22H27N2O+ — CID 45135658
1,3-bis(4-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol (PubChem CID 45135658) has the molecular formula C22H27N2O+ and a molecular weight of 335.47 g/mol. Its IUPAC name is 1,3-bis(4-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol.
| Compound Name | 1,3-bis(4-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
|---|---|
| PubChem CID | 45135658 |
| Molecular Formula | C22H27N2O+ |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 1,3-bis(4-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
| SMILES | Cc1ccc(N2CC(O)(c3ccc(C)cc3)[N+]3=C2CCCCC3)cc1 |
| InChI | InChI=1S/C22H27N2O/c1-17-7-11-19(12-8-17)22(25)16-23(20-13-9-18(2)10-14-20)21-6-4-3-5-15-24(21)22/h7-14,25H,3-6,15-16H2,1-2H3/q+1 |
| InChIKey | YKYUBRVIYRTYDY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|