C22H24BrF3N2O — CID 45135182
3-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide (PubChem CID 45135182) has the molecular formula C22H24BrF3N2O and a molecular weight of 469.35 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide.
| Compound Name | 3-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
|---|---|
| PubChem CID | 45135182 |
| Molecular Formula | C22H24BrF3N2O |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 3-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
| SMILES | Cc1ccc(C2(O)CN(c3cccc(C(F)(F)F)c3)C3=[N+]2CCCCC3)cc1.[Br-] |
| InChI | InChI=1S/C22H24F3N2O.BrH/c1-16-9-11-17(12-10-16)21(28)15-26(20-8-3-2-4-13-27(20)21)19-7-5-6-18(14-19)22(23,24)25;/h5-7,9-12,14,28H,2-4,8,13,15H2,1H3;1H/q+1;/p-1 |
| InChIKey | WQCPYHUTDXOQJI-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|