C19H20F3N2OS+ — CID 3809655
3-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol (PubChem CID 3809655) has the molecular formula C19H20F3N2OS+ and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol.
| Compound Name | 3-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
|---|---|
| PubChem CID | 3809655 |
| Molecular Formula | C19H20F3N2OS+ |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
| SMILES | OC1(c2cccs2)CN(c2cccc(C(F)(F)F)c2)C2=[N+]1CCCCC2 |
| InChI | InChI=1S/C19H20F3N2OS/c20-19(21,22)14-6-4-7-15(12-14)23-13-18(25,16-8-5-11-26-16)24-10-3-1-2-9-17(23)24/h4-8,11-12,25H,1-3,9-10,13H2/q+1 |
| InChIKey | KYSGVHZUAPQQRT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|