C21H20F3N2+ — CID 21176882
2-phenyl-1-[3-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium (PubChem CID 21176882) has the molecular formula C21H20F3N2+ and a molecular weight of 357.40 g/mol. Its IUPAC name is 2-phenyl-1-[3-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium.
| Compound Name | 2-phenyl-1-[3-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium |
|---|---|
| PubChem CID | 21176882 |
| Molecular Formula | C21H20F3N2+ |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-phenyl-1-[3-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium |
| SMILES | FC(F)(F)c1cccc(-n2c(-c3ccccc3)c[n+]3c2CCCCC3)c1 |
| InChI | InChI=1S/C21H20F3N2/c22-21(23,24)17-10-7-11-18(14-17)26-19(16-8-3-1-4-9-16)15-25-13-6-2-5-12-20(25)26/h1,3-4,7-11,14-15H,2,5-6,12-13H2/q+1 |
| InChIKey | NWIFEDQYWBECBY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|