C20H20F3N2+ — CID 2386120
5-benzyl-3-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium (PubChem CID 2386120) has the molecular formula C20H20F3N2+ and a molecular weight of 345.39 g/mol. Its IUPAC name is 5-benzyl-3-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium.
| Compound Name | 5-benzyl-3-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium |
|---|---|
| PubChem CID | 2386120 |
| Molecular Formula | C20H20F3N2+ |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 5-benzyl-3-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium |
| SMILES | FC(F)(F)c1ccc2c(c1)n(Cc1ccccc1)c1[n+]2CCCCC1 |
| InChI | InChI=1S/C20H20F3N2/c21-20(22,23)16-10-11-17-18(13-16)25(14-15-7-3-1-4-8-15)19-9-5-2-6-12-24(17)19/h1,3-4,7-8,10-11,13H,2,5-6,9,12,14H2/q+1 |
| InChIKey | BNYDCBFYXHWIOH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|