C18H18F3N2+ — CID 148796992
1-benzyl-3-ethyl-2-methyl-5-(trifluoromethyl)benzimidazol-1-ium (PubChem CID 148796992) has the molecular formula C18H18F3N2+ and a molecular weight of 319.35 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-2-methyl-5-(trifluoromethyl)benzimidazol-1-ium.
| Compound Name | 1-benzyl-3-ethyl-2-methyl-5-(trifluoromethyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 148796992 |
| Molecular Formula | C18H18F3N2+ |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-benzyl-3-ethyl-2-methyl-5-(trifluoromethyl)benzimidazol-1-ium |
| SMILES | CCn1c(C)[n+](Cc2ccccc2)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H18F3N2/c1-3-22-13(2)23(12-14-7-5-4-6-8-14)16-10-9-15(11-17(16)22)18(19,20)21/h4-11H,3,12H2,1-2H3/q+1 |
| InChIKey | ONGZHOBFMCTSHQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|