C12H11F6N2+ — CID 19763175
1,2-dimethyl-3-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)benzimidazol-1-ium (PubChem CID 19763175) has the molecular formula C12H11F6N2+ and a molecular weight of 297.22 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)benzimidazol-1-ium.
| Compound Name | 1,2-dimethyl-3-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 19763175 |
| Molecular Formula | C12H11F6N2+ |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1,2-dimethyl-3-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)benzimidazol-1-ium |
| SMILES | Cc1n(CC(F)(F)F)c2cc(C(F)(F)F)ccc2[n+]1C |
| InChI | InChI=1S/C12H11F6N2/c1-7-19(2)9-4-3-8(12(16,17)18)5-10(9)20(7)6-11(13,14)15/h3-5H,6H2,1-2H3/q+1 |
| InChIKey | DSYBPQWGRZIZIE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|