C13H14F3NO2 — CID 118259006
5-tert-butyl-3-(2,2,2-trifluoroethyl)-1,3-benzoxazol-2-one (PubChem CID 118259006) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,2,2-trifluoroethyl)-1,3-benzoxazol-2-one.
| Compound Name | 5-tert-butyl-3-(2,2,2-trifluoroethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 118259006 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 5-tert-butyl-3-(2,2,2-trifluoroethyl)-1,3-benzoxazol-2-one |
| SMILES | CC(C)(C)c1ccc2oc(=O)n(CC(F)(F)F)c2c1 |
| InChI | InChI=1S/C13H14F3NO2/c1-12(2,3)8-4-5-10-9(6-8)17(11(18)19-10)7-13(14,15)16/h4-6H,7H2,1-3H3 |
| InChIKey | HWGBYRIMXBTHLU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |