C10H9F2NO2 — CID 116841588
6-(1,1-difluoroethyl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116841588) has the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. Its IUPAC name is 6-(1,1-difluoroethyl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(1,1-difluoroethyl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116841588 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 6-(1,1-difluoroethyl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(C)(F)F)ccc21 |
| InChI | InChI=1S/C10H9F2NO2/c1-10(11,12)6-3-4-7-8(5-6)15-9(14)13(7)2/h3-5H,1-2H3 |
| InChIKey | GHQMKCVLMAMOOR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |