C12H17N3O2 — CID 116932681
6-(1,2-diamino-2-methylpropyl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116932681) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-(1,2-diamino-2-methylpropyl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(1,2-diamino-2-methylpropyl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116932681 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-(1,2-diamino-2-methylpropyl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(N)C(C)(C)N)ccc21 |
| InChI | InChI=1S/C12H17N3O2/c1-12(2,14)10(13)7-4-5-8-9(6-7)17-11(16)15(8)3/h4-6,10H,13-14H2,1-3H3 |
| InChIKey | ZOAJBFJUZVCJBE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |