C21H21ClF3N3O — CID 12006281
N-phenyl-2-[3-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium-5-yl]acetamide chloride (PubChem CID 12006281) has the molecular formula C21H21ClF3N3O and a molecular weight of 423.87 g/mol. Its IUPAC name is N-phenyl-2-[3-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium-5-yl]acetamide chloride.
| Compound Name | N-phenyl-2-[3-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium-5-yl]acetamide chloride |
|---|---|
| PubChem CID | 12006281 |
| Molecular Formula | C21H21ClF3N3O |
| Molecular Weight | 423.87 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-phenyl-2-[3-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium-5-yl]acetamide chloride |
| SMILES | O=C(Cn1c2[n+](c3ccc(C(F)(F)F)cc31)CCCCC2)Nc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H20F3N3O.ClH/c22-21(23,24)15-10-11-17-18(13-15)27(20-9-5-2-6-12-26(17)20)14-19(28)25-16-7-3-1-4-8-16;/h1,3-4,7-8,10-11,13H,2,5-6,9,12,14H2;1H |
| InChIKey | CKINWLPITKTYNS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.87 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|